ChemNet > CAS > 14857-34-2 Dimethylethoxysilane
14857-34-2 Dimethylethoxysilane
| نام محصول |
Dimethylethoxysilane |
| نام انگلیسی |
Dimethylethoxysilane; Ethoxydimethylsilane; Ethoxydimethylvinylsilane; Vinyldimethylethoxysilane; ethoxy(dimethyl)silyl |
| میدان مغناطیسی |
C4H11OSi |
| وزن مولکولی |
103.215 |
| InChI |
InChI=1/C4H11OSi/c1-4-5-6(2)3/h4H2,1-3H3 |
| شماره سیایاس |
14857-34-2 |
| تعداد کمیسیون اروپایی |
238-921-7 |
| ساختار مولکولی |
|
| خطر نمادها |
|
| کدهای خطر |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
