1539-04-4 Diphenyl tere-phthalate
نام محصول |
Diphenyl tere-phthalate |
نام انگلیسی |
Diphenyl tere-phthalate; Diphenyl terephthalate; Terephthalic acid diphenyl ester; diphenyl benzene-1,4-dicarboxylate |
میدان مغناطیسی |
C20H14O4 |
وزن مولکولی |
318.3228 |
InChI |
InChI=1/C20H14O4/c21-19(23-17-7-3-1-4-8-17)15-11-13-16(14-12-15)20(22)24-18-9-5-2-6-10-18/h1-14H |
شماره سیایاس |
1539-04-4 |
تعداد کمیسیون اروپایی |
216-264-7 |
ساختار مولکولی |
|
تراکم |
1.242g/cm3 |
نقطه ذوب |
197-199℃ |
نقطه غلیان |
496.6°C at 760 mmHg |
ضریب شکست |
1.615 |
نقطه اشتعال |
255°C |
فشار بخار |
5.34E-10mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|