ChemNet > CAS > 154257-75-7 3-Chloro-2,4-difluorobenzoic acid
154257-75-7 3-Chloro-2,4-difluorobenzoic acid
نام محصول |
3-Chloro-2,4-difluorobenzoic acid |
نام انگلیسی |
3-Chloro-2,4-difluorobenzoic acid; 1-fluoro-4-isothiocyanatobenzene; 3-chloro-2,4-difluorobenzoate; 3-Chloro-2,4-Difluoro-Benzoic Acid |
میدان مغناطیسی |
C7H2ClF2O2 |
وزن مولکولی |
191.5399 |
InChI |
InChI=1/C7H3ClF2O2/c8-5-4(9)2-1-3(6(5)10)7(11)12/h1-2H,(H,11,12)/p-1 |
شماره سیایاس |
154257-75-7 |
تعداد کمیسیون اروپایی |
216-280-4 |
ساختار مولکولی |
|
نقطه غلیان |
276.7°C at 760 mmHg |
نقطه اشتعال |
121.1°C |
فشار بخار |
0.00228mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|