ChemNet > CAS > 1544-86-1 4-(difluoromethoxy)nitrobenzene
1544-86-1 4-(difluoromethoxy)nitrobenzene
| نام محصول |
4-(difluoromethoxy)nitrobenzene |
| نام انگلیسی |
4-(difluoromethoxy)nitrobenzene; 1-(Difluoromethoxy)-4-nitrobenzene; 1-(difluoromethyl)-4-nitrobenzene |
| میدان مغناطیسی |
C7H5F2NO2 |
| وزن مولکولی |
173.1169 |
| InChI |
InChI=1/C7H5F2NO2/c8-7(9)5-1-3-6(4-2-5)10(11)12/h1-4,7H |
| شماره سیایاس |
1544-86-1 |
| ساختار مولکولی |
|
| تراکم |
1.339g/cm3 |
| نقطه ذوب |
33-110℃ |
| نقطه غلیان |
240.7°C at 760 mmHg |
| ضریب شکست |
1.5 |
| نقطه اشتعال |
111.9°C |
| فشار بخار |
0.0578mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
