15518-68-0 Fast Blue BB salt
نام محصول |
Fast Blue BB salt |
نام انگلیسی |
Fast Blue BB salt; Azoic Diazo No. 20; 4-(phenylcarboxamido)-2,5-diethoxybenzenediazonium chloride; 4-(benzoylamino)-2,5-diethoxybenzenediazonium hexafluorophosphate; 2,5-diethoxy-4-[(phenylcarbonyl)amino]benzenediazonium chloride |
میدان مغناطیسی |
C17H18ClN3O3 |
وزن مولکولی |
347.7961 |
InChI |
InChI=1/C17H17N3O3.ClH/c1-3-22-15-11-14(20-18)16(23-4-2)10-13(15)19-17(21)12-8-6-5-7-9-12;/h5-11H,3-4H2,1-2H3;1H |
شماره سیایاس |
15518-68-0 |
تعداد کمیسیون اروپایی |
239-549-8 |
ساختار مولکولی |
|
نقطه ذوب |
157℃ |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|