ChemNet > CAS > 15690-25-2 3-(2-Thienyl)acrylic acid
15690-25-2 3-(2-Thienyl)acrylic acid
نام محصول |
3-(2-Thienyl)acrylic acid |
نام انگلیسی |
3-(2-Thienyl)acrylic acid; Thiophene-2-acrylic acid; 3-(2-Thiophenyl)propenoic acid; (2E)-3-thiophen-2-ylprop-2-enoate |
میدان مغناطیسی |
C7H5O2S |
وزن مولکولی |
153.1789 |
InChI |
InChI=1/C7H6O2S/c8-7(9)4-3-6-2-1-5-10-6/h1-5H,(H,8,9)/p-1/b4-3+ |
شماره سیایاس |
15690-25-2 |
ساختار مولکولی |
|
نقطه ذوب |
145-148℃ |
نقطه غلیان |
298.9°C at 760 mmHg |
نقطه اشتعال |
134.6°C |
فشار بخار |
0.000551mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|