ChemNet > CAS > 1576-85-8 4-Penten-1-yl acetate
1576-85-8 4-Penten-1-yl acetate
| نام محصول |
4-Penten-1-yl acetate |
| نام انگلیسی |
4-Penten-1-yl acetate; 5-Acetoxy-1-pentene; pent-4-ene-1-yl acetate; Acetic Acid 4-Penten-1-yl Ester; pent-4-en-1-yl acetate |
| میدان مغناطیسی |
C7H12O2 |
| وزن مولکولی |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-3-4-5-6-9-7(2)8/h3H,1,4-6H2,2H3 |
| شماره سیایاس |
1576-85-8 |
| تعداد کمیسیون اروپایی |
216-413-6 |
| ساختار مولکولی |
|
| تراکم |
0.898g/cm3 |
| نقطه غلیان |
145°C at 760 mmHg |
| ضریب شکست |
1.418 |
| نقطه اشتعال |
45.6°C |
| فشار بخار |
4.96mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
