ChemNet > CAS > 1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
نام محصول |
Cyclohexanone 2,4-dinitrophenylhydrazone |
نام انگلیسی |
Cyclohexanone 2,4-dinitrophenylhydrazone;Cyclohexanone-2,4-dinitrophenylhydrazone; AI3-16296; Cyclohexanone, (2,4-dinitrophenyl)hydrazone; 1-cyclohexylidene-2-(2,4-dinitrophenyl)hydrazine |
میدان مغناطیسی |
C12H14N4O4 |
وزن مولکولی |
278.264 |
InChI |
InChI=1/C12H14N4O4/c17-15(18)10-6-7-11(12(8-10)16(19)20)14-13-9-4-2-1-3-5-9/h6-8,14H,1-5H2 |
شماره سیایاس |
1589-62-4 |
تعداد کمیسیون اروپایی |
216-458-1 |
ساختار مولکولی |
|
تراکم |
1.47g/cm3 |
نقطه ذوب |
159-161℃ |
نقطه غلیان |
434.6°C at 760 mmHg |
ضریب شکست |
1.665 |
نقطه اشتعال |
216.7°C |
فشار بخار |
9.33E-08mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|