1635-31-0 3-Aminocoumarin
نام محصول |
3-Aminocoumarin |
نام انگلیسی |
3-Aminocoumarin; 3-Coumarinamine; 3-amino-2H-chromen-2-one |
میدان مغناطیسی |
C9H7NO2 |
وزن مولکولی |
161.1574 |
InChI |
InChI=1/C9H7NO2/c10-7-5-6-3-1-2-4-8(6)12-9(7)11/h1-5H,10H2 |
شماره سیایاس |
1635-31-0 |
تعداد کمیسیون اروپایی |
216-659-4 |
ساختار مولکولی |
|
تراکم |
1.313g/cm3 |
نقطه غلیان |
355.2°C at 760 mmHg |
ضریب شکست |
1.624 |
نقطه اشتعال |
199.3°C |
فشار بخار |
3.17E-05mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|