ChemNet > CAS > 163517-62-2 5-fluoro-2-methylphenylboronic acid
163517-62-2 5-fluoro-2-methylphenylboronic acid
نام محصول |
5-fluoro-2-methylphenylboronic acid |
نام انگلیسی |
5-fluoro-2-methylphenylboronic acid; 5-Fluoro-2-methylphenylboronic acid~5-Fluoro-o-tolylboronic acid; 5-Fluoro-2-methylbenzeneboronic acid |
میدان مغناطیسی |
C7H8BFO2 |
وزن مولکولی |
153.9466 |
InChI |
InChI=1/C7H8BFO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,10-11H,1H3 |
شماره سیایاس |
163517-62-2 |
ساختار مولکولی |
|
تراکم |
1.2g/cm3 |
نقطه غلیان |
287.7°C at 760 mmHg |
ضریب شکست |
1.505 |
نقطه اشتعال |
127.8°C |
فشار بخار |
0.00113mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|