ChemNet > CAS > 1638-86-4 Diethyl phenylphosphonite
1638-86-4 Diethyl phenylphosphonite
نام محصول |
Diethyl phenylphosphonite |
نام انگلیسی |
Diethyl phenylphosphonite; Diethoxyphenylphosphine; Phenylphosphonous acid diethyl ester |
میدان مغناطیسی |
C10H15O2P |
وزن مولکولی |
198.1987 |
InChI |
InChI=1/C10H15O2P/c1-3-11-13(12-4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
شماره سیایاس |
1638-86-4 |
تعداد کمیسیون اروپایی |
216-676-7 |
ساختار مولکولی |
|
نقطه غلیان |
235°C at 760 mmHg |
نقطه اشتعال |
113°C |
فشار بخار |
0.0784mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|