ChemNet > CAS > 1643-15-8 (m-Tolyloxy)-acetic acid
1643-15-8 (m-Tolyloxy)-acetic acid
نام محصول |
(m-Tolyloxy)-acetic acid |
نام انگلیسی |
(m-Tolyloxy)-acetic acid; 3-Methylphenoxyacetic acid; (3-methylphenoxy)acetic acid; (3-methylphenoxy)acetate |
میدان مغناطیسی |
C9H9O3 |
وزن مولکولی |
165.1665 |
InChI |
InChI=1/C9H10O3/c1-7-3-2-4-8(5-7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
شماره سیایاس |
1643-15-8 |
تعداد کمیسیون اروپایی |
216-698-7 |
ساختار مولکولی |
|
نقطه غلیان |
300°C at 760 mmHg |
نقطه اشتعال |
121.4°C |
فشار بخار |
0.000512mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|