16649-49-3 (Acetic anhydride)-d6
نام محصول |
(Acetic anhydride)-d6 |
نام انگلیسی |
(Acetic anhydride)-d6;(2H3)Acetic anhydride; (~2~H_3_)ethanoic anhydride |
میدان مغناطیسی |
C4D6O3 |
وزن مولکولی |
108.1256 |
InChI |
InChI=1/C4H6O3/c1-3(5)7-4(2)6/h1-2H3/i1D3,2D3 |
شماره سیایاس |
16649-49-3 |
تعداد کمیسیون اروپایی |
240-697-0 |
ساختار مولکولی |
|
تراکم |
1.136g/cm3 |
نقطه غلیان |
141.1°C at 760 mmHg |
ضریب شکست |
1.386 |
نقطه اشتعال |
54.4°C |
فشار بخار |
5.94mmHg at 25°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R10:Flammable.;
R20/22:Harmful by inhalation and if swallowed.;
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|