ChemNet > CAS > 16932-49-3 2,6-Dimethoxybenzonitrile
16932-49-3 2,6-Dimethoxybenzonitrile
نام محصول |
2,6-Dimethoxybenzonitrile |
نام انگلیسی |
2,6-Dimethoxybenzonitrile;Benzonitrile, 2,6-dimethoxy-; 2-10-00-00260 (Beilstein Handbook Reference); BRN 2720059 |
میدان مغناطیسی |
C9H9NO2 |
وزن مولکولی |
163.1733 |
InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-5H,1-2H3 |
شماره سیایاس |
16932-49-3 |
تعداد کمیسیون اروپایی |
241-000-2 |
ساختار مولکولی |
|
تراکم |
1.12g/cm3 |
نقطه ذوب |
119-123℃ |
نقطه غلیان |
306.7°C at 760 mmHg |
ضریب شکست |
1.519 |
نقطه اشتعال |
128.8°C |
فشار بخار |
0.000758mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|