ChemNet > CAS > 1706-11-2 2,5-Dimethylanisole
1706-11-2 2,5-Dimethylanisole
| نام محصول |
2,5-Dimethylanisole |
| نام انگلیسی |
2,5-Dimethylanisole; 1,4-Dimethyl-2-methoxybenzene; 2-Methoxy-p-xylene; 2,5-dimethylphenyl methyl ether |
| میدان مغناطیسی |
C9H12O |
| وزن مولکولی |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-4-5-8(2)9(6-7)10-3/h4-6H,1-3H3 |
| شماره سیایاس |
1706-11-2 |
| تعداد کمیسیون اروپایی |
216-943-8 |
| ساختار مولکولی |
|
| تراکم |
0.932g/cm3 |
| نقطه غلیان |
189.7°C at 760 mmHg |
| ضریب شکست |
1.495 |
| نقطه اشتعال |
66.1°C |
| فشار بخار |
0.778mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
