ChemNet > CAS > 17217-57-1 4,4'-Dimethoxy-2,2'-bipyridine
17217-57-1 4,4'-Dimethoxy-2,2'-bipyridine
| نام محصول |
4,4'-Dimethoxy-2,2'-bipyridine |
| نام انگلیسی |
4,4'-Dimethoxy-2,2'-bipyridine; 4,4'-Dimethoxy-[2,2']bipyridinyl |
| میدان مغناطیسی |
C12H12N2O2 |
| وزن مولکولی |
216.2359 |
| InChI |
InChI=1/C12H12N2O2/c1-15-9-3-5-13-11(7-9)12-8-10(16-2)4-6-14-12/h3-8H,1-2H3 |
| شماره سیایاس |
17217-57-1 |
| ساختار مولکولی |
|
| تراکم |
1.143g/cm3 |
| نقطه ذوب |
170-171℃ |
| نقطه غلیان |
347.6°C at 760 mmHg |
| ضریب شکست |
1.551 |
| نقطه اشتعال |
127°C |
| فشار بخار |
0.000107mmHg at 25°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|
