ChemNet > CAS > 17249-79-5;17249-29-5 2,3-Dichlorothiophene
17249-79-5;17249-29-5 2,3-Dichlorothiophene
| نام محصول |
2,3-Dichlorothiophene |
| نام انگلیسی |
2,3-Dichlorothiophene; 2,3-dichloro-thiophene |
| میدان مغناطیسی |
C4H2Cl2S |
| وزن مولکولی |
153.0297 |
| InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
| شماره سیایاس |
17249-79-5;17249-29-5 |
| ساختار مولکولی |
|
| تراکم |
1.488g/cm3 |
| نقطه ذوب |
-26℃ |
| نقطه غلیان |
170.7°C at 760 mmHg |
| ضریب شکست |
1.584 |
| نقطه اشتعال |
68.9°C |
| فشار بخار |
1.93mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
