ChemNet > CAS > 17299-07-9 (2R,5R)-(-)-2,5-Hexanediol
17299-07-9 (2R,5R)-(-)-2,5-Hexanediol
| نام محصول |
(2R,5R)-(-)-2,5-Hexanediol |
| نام انگلیسی |
(2R,5R)-(-)-2,5-Hexanediol; (2R,5R)-2,5-Hexanediol; Hexanediolcolorlessxtl; (2R,5R)-Dihydroxyhexane; (2R,5R)-hexane-2,5-diol |
| میدان مغناطیسی |
C6H14O2 |
| وزن مولکولی |
118.1742 |
| InChI |
InChI=1/C6H14O2/c1-5(7)3-4-6(2)8/h5-8H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| شماره سیایاس |
17299-07-9 |
| ساختار مولکولی |
|
| تراکم |
0.958g/cm3 |
| نقطه ذوب |
50-53℃ |
| نقطه غلیان |
213.4°C at 760 mmHg |
| ضریب شکست |
1.445 |
| نقطه اشتعال |
101.7°C |
| فشار بخار |
0.0364mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
