17356-19-3 1-Ethynylcyclopentanol
نام محصول |
1-Ethynylcyclopentanol |
نام انگلیسی |
1-Ethynylcyclopentanol; |
میدان مغناطیسی |
C7H10O |
وزن مولکولی |
110.1537 |
InChI |
InChI=1/C7H10O/c1-2-7(8)5-3-4-6-7/h1,8H,3-6H2 |
شماره سیایاس |
17356-19-3 |
تعداد کمیسیون اروپایی |
241-385-7 |
ساختار مولکولی |
|
تراکم |
1.01g/cm3 |
نقطه ذوب |
27-159℃ |
نقطه غلیان |
155.4°C at 760 mmHg |
ضریب شکست |
1.497 |
نقطه اشتعال |
48.9°C |
فشار بخار |
1.1mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R10:Flammable.;
R22:Harmful if swallowed.;
R36/37:Irritating to eyes and respiratory system.;
|
توضیحات ایمنی |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|