ChemNet > CAS > 175278-41-8 3- (3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl) اسید اکریلیک؛ (2E) -3- (3-nitro-4-pyrrolidin-1-ylphenyl) prop-2-enoic acid؛
175278-41-8 3- (3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl) اسید اکریلیک؛ (2E) -3- (3-nitro-4-pyrrolidin-1-ylphenyl) prop-2-enoic acid؛
| نام محصول |
3- (3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl) اسید اکریلیک؛ (2E) -3- (3-nitro-4-pyrrolidin-1-ylphenyl) prop-2-enoic acid؛ |
| نام انگلیسی |
3-(3-nitro-4-tetrahydro-1H-pyrrol-1-ylphenyl)acrylic acid;(2E)-3-(3-nitro-4-pyrrolidin-1-ylphenyl)prop-2-enoic acid |
| میدان مغناطیسی |
C13H14N2O4 |
| وزن مولکولی |
262.2613 |
| InChI |
InChI=1/C13H14N2O4/c16-13(17)6-4-10-3-5-11(12(9-10)15(18)19)14-7-1-2-8-14/h3-6,9H,1-2,7-8H2,(H,16,17)/b6-4+ |
| شماره سیایاس |
175278-41-8 |
| ساختار مولکولی |
|
| تراکم |
1.37g/cm3 |
| نقطه ذوب |
243℃ |
| نقطه غلیان |
483.9°C at 760 mmHg |
| ضریب شکست |
1.657 |
| نقطه اشتعال |
246.5°C |
| فشار بخار |
3.54E-10mmHg at 25°C |
| خطر نمادها |
Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|