ChemNet > CAS > 175883-62-2 (4-Methoxy-3-methylphenyl)boronic acid
175883-62-2 (4-Methoxy-3-methylphenyl)boronic acid
نام محصول |
(4-Methoxy-3-methylphenyl)boronic acid |
نام انگلیسی |
(4-Methoxy-3-methylphenyl)boronic acid; 4-Methoxy-3-methylphenylboronic acid; 4-Methoxy-3-methylbenzeneboronic acid |
میدان مغناطیسی |
C8H11BO3 |
وزن مولکولی |
165.9821 |
InChI |
InChI=1/C8H11BO3/c1-6-5-7(9(10)11)3-4-8(6)12-2/h3-5,10-11H,1-2H3 |
شماره سیایاس |
175883-62-2 |
ساختار مولکولی |
|
تراکم |
1.14g/cm3 |
نقطه غلیان |
321.4°C at 760 mmHg |
ضریب شکست |
1.52 |
نقطه اشتعال |
148.2°C |
فشار بخار |
0.000124mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|