ChemNet > CAS > 177787-26-7 3,4,5-trifluorobenzoyl chloride
177787-26-7 3,4,5-trifluorobenzoyl chloride
نام محصول |
3,4,5-trifluorobenzoyl chloride |
نام انگلیسی |
3,4,5-trifluorobenzoyl chloride; |
میدان مغناطیسی |
C7H2ClF3O |
وزن مولکولی |
194.5384 |
InChI |
InChI=1/C7H2ClF3O/c8-7(12)3-1-4(9)6(11)5(10)2-3/h1-2H |
شماره سیایاس |
177787-26-7 |
ساختار مولکولی |
|
تراکم |
1.514g/cm3 |
نقطه غلیان |
184.7°C at 760 mmHg |
ضریب شکست |
1.479 |
نقطه اشتعال |
65.5°C |
فشار بخار |
0.722mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|