ChemNet > CAS > 18355-80-1 2,3-difluoroacetophenone
18355-80-1 2,3-difluoroacetophenone
نام محصول |
2,3-difluoroacetophenone |
نام انگلیسی |
2,3-difluoroacetophenone; 2',3'-difluoroacetophenone; 1-(2,3-difluorophenyl)ethanone |
میدان مغناطیسی |
C8H6F2O |
وزن مولکولی |
156.1294 |
InChI |
InChI=1/C8H6F2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
شماره سیایاس |
18355-80-1 |
ساختار مولکولی |
|
تراکم |
1.206g/cm3 |
نقطه غلیان |
193.4°C at 760 mmHg |
ضریب شکست |
1.472 |
نقطه اشتعال |
71.5°C |
فشار بخار |
0.465mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|