ChemNet > CAS > 18635-45-5 2,3-Diaminopropionic acid hydrobromide
18635-45-5 2,3-Diaminopropionic acid hydrobromide
نام محصول |
2,3-Diaminopropionic acid hydrobromide |
نام انگلیسی |
2,3-Diaminopropionic acid hydrobromide;(2S)-2,3-diammoniopropanoate; (2R)-2,3-diammoniopropanoate |
میدان مغناطیسی |
C3H9N2O2 |
وزن مولکولی |
105.1152 |
InChI |
InChI=1/C3H8N2O2/c4-1-2(5)3(6)7/h2H,1,4-5H2,(H,6,7)/p+1/t2-/m1/s1 |
شماره سیایاس |
18635-45-5 |
تعداد کمیسیون اروپایی |
242-467-5 |
ساختار مولکولی |
|
نقطه ذوب |
232℃ |
نقطه غلیان |
325.6°C at 760 mmHg |
نقطه اشتعال |
150.7°C |
فشار بخار |
4.58E-05mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|