ChemNet > CAS > 186590-26-1 5-Bromo-2,3-difluorophenol
186590-26-1 5-Bromo-2,3-difluorophenol
نام محصول |
5-Bromo-2,3-difluorophenol |
نام انگلیسی |
5-Bromo-2,3-difluorophenol; Bromodifluorophenol5; 3-Bromo-5,6-difluorophenol; 2,3-difluoro-5-bromophenol; bis[3-(trifluoromethyl)phenyl]methanone |
میدان مغناطیسی |
C6H3BrF2O |
وزن مولکولی |
208.9882 |
InChI |
InChI=1/C6H3BrF2O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
شماره سیایاس |
186590-26-1 |
ساختار مولکولی |
|
تراکم |
1.858g/cm3 |
نقطه غلیان |
212.2°C at 760 mmHg |
ضریب شکست |
1.549 |
نقطه اشتعال |
82.1°C |
فشار بخار |
0.121mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|