ChemNet > CAS > 1871-67-6 2-Octenoic acid
1871-67-6 2-Octenoic acid
| نام محصول |
2-Octenoic acid |
| نام انگلیسی |
2-Octenoic acid; Octenoicacidpract; 2-Octenoic acid,predominantly trans; trans-2-Octenoic acid; oct-2-enoate |
| میدان مغناطیسی |
C8H13O2 |
| وزن مولکولی |
141.1882 |
| InChI |
InChI=1/C8H14O2/c1-2-3-4-5-6-7-8(9)10/h6-7H,2-5H2,1H3,(H,9,10)/p-1 |
| شماره سیایاس |
1871-67-6 |
| تعداد کمیسیون اروپایی |
217-491-4 |
| ساختار مولکولی |
|
| نقطه ذوب |
5-6℃ |
| نقطه غلیان |
260.2°C at 760 mmHg |
| نقطه اشتعال |
151.1°C |
| فشار بخار |
0.0037mmHg at 25°C |
| خطر نمادها |
 C:Corrosive;
|
| کدهای خطر |
R34:Causes burns.;
|
| توضیحات ایمنی |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
