ChemNet > CAS > 1877-71-0 Methyl hydrogen isophthalate
1877-71-0 Methyl hydrogen isophthalate
| نام محصول |
Methyl hydrogen isophthalate |
| نام انگلیسی |
Methyl hydrogen isophthalate; Monomethyl isophthalate; Isophthalic acid monomethyl ester; Benzene-1,3-dicarboxylic acid monomethyl ester; 3-(methoxycarbonyl)benzoic acid; Mono-methyl isophthalate; Isophthalic acid methyl ester |
| میدان مغناطیسی |
C9H8O4 |
| وزن مولکولی |
180.1574 |
| InChI |
InChI=1/C9H8O4/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2-5H,1H3,(H,10,11) |
| شماره سیایاس |
1877-71-0 |
| ساختار مولکولی |
|
| تراکم |
1.288g/cm3 |
| نقطه ذوب |
194-196℃ |
| نقطه غلیان |
339.3°C at 760 mmHg |
| ضریب شکست |
1.556 |
| نقطه اشتعال |
139.6°C |
| فشار بخار |
3.6E-05mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
