ChemNet > CAS > 1912-43-2 2-methyl-3-indoleacetic acid
1912-43-2 2-methyl-3-indoleacetic acid
نام محصول |
2-methyl-3-indoleacetic acid |
نام انگلیسی |
2-methyl-3-indoleacetic acid; 2-Methylindole-3-acetic acid; (2-methyl-1H-indol-3-yl)acetic acid |
میدان مغناطیسی |
C11H11NO2 |
وزن مولکولی |
189.2026 |
InChI |
InChI=1/C11H11NO2/c1-7-9(6-11(13)14)8-4-2-3-5-10(8)12-7/h2-5,12H,6H2,1H3,(H,13,14) |
شماره سیایاس |
1912-43-2 |
ساختار مولکولی |
|
نقطه ذوب |
205℃ |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|