ChemNet > CAS > 19241-36-2 5-Chloro-2-methylphenyl isothiocyanate
19241-36-2 5-Chloro-2-methylphenyl isothiocyanate
| نام محصول |
5-Chloro-2-methylphenyl isothiocyanate |
| نام انگلیسی |
5-Chloro-2-methylphenyl isothiocyanate; 3-Chloro-6-methylisothiocyanatobenzene; 4-chloro-2-isothiocyanato-1-methylbenzene |
| میدان مغناطیسی |
C8H6ClNS |
| وزن مولکولی |
183.6579 |
| InChI |
InChI=1/C8H6ClNS/c1-6-2-3-7(9)4-8(6)10-5-11/h2-4H,1H3 |
| شماره سیایاس |
19241-36-2 |
| ساختار مولکولی |
|
| تراکم |
1.18g/cm3 |
| نقطه غلیان |
293°C at 760 mmHg |
| ضریب شکست |
1.583 |
| نقطه اشتعال |
131°C |
| فشار بخار |
0.0031mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
