1968-40-7 Ethyl pent-4-enoate
نام محصول |
Ethyl pent-4-enoate |
نام انگلیسی |
Ethyl pent-4-enoate; Ethyl pent-4-enoate, (Ethyl allylacetate; Pent-4-enoic aci; Ethyl allylacetate; 4-Pentenoic acid ethyl ester; Ethyl 4-pentenoate |
میدان مغناطیسی |
C7H12O2 |
وزن مولکولی |
128.169 |
InChI |
InChI=1/C7H12O2/c1-3-5-6-7(8)9-4-2/h3H,1,4-6H2,2H3 |
شماره سیایاس |
1968-40-7 |
تعداد کمیسیون اروپایی |
217-818-0 |
ساختار مولکولی |
|
تراکم |
0.898g/cm3 |
نقطه غلیان |
122.8°C at 760 mmHg |
ضریب شکست |
1.418 |
نقطه اشتعال |
33.7°C |
فشار بخار |
13.7mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|