ChemNet > CAS > 19879-84-6 1-thio-beta-D-glucose tetraacetate
19879-84-6 1-thio-beta-D-glucose tetraacetate
نام محصول |
1-thio-beta-D-glucose tetraacetate |
نام انگلیسی |
1-thio-beta-D-glucose tetraacetate;1-Thio-beta-D-glucose 2,3,4,6-tetraacetate; 2,3,4,6-tetra-O-acetyl-1-thio-beta-D-glucopyranose; 2,3,4,6-tetra-O-acetyl-1-thiohexopyranose |
میدان مغناطیسی |
C14H20O9S |
وزن مولکولی |
364.3682 |
InChI |
InChI=1/C14H20O9S/c1-6(15)19-5-10-11(20-7(2)16)12(21-8(3)17)13(14(24)23-10)22-9(4)18/h10-14,24H,5H2,1-4H3 |
شماره سیایاس |
19879-84-6 |
تعداد کمیسیون اروپایی |
243-392-0 |
ساختار مولکولی |
|
تراکم |
1.31g/cm3 |
نقطه ذوب |
115-117℃ |
نقطه غلیان |
425.5°C at 760 mmHg |
ضریب شکست |
1.502 |
نقطه اشتعال |
298°C |
فشار بخار |
1.9E-07mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|