ChemNet > CAS > 199866-90-5 1,4-difluoro-2,5-dimethoxybenzene
199866-90-5 1,4-difluoro-2,5-dimethoxybenzene
نام محصول |
1,4-difluoro-2,5-dimethoxybenzene |
نام انگلیسی |
1,4-difluoro-2,5-dimethoxybenzene; |
میدان مغناطیسی |
C8H8F2O2 |
وزن مولکولی |
174.1447 |
InChI |
InChI=1/C8H8F2O2/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,1-2H3 |
شماره سیایاس |
199866-90-5 |
ساختار مولکولی |
|
تراکم |
1.193g/cm3 |
نقطه غلیان |
193.7°C at 760 mmHg |
ضریب شکست |
1.455 |
نقطه اشتعال |
77.4°C |
فشار بخار |
0.64mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|