ChemNet > CAS > 2024-83-1 3,4-Dimethoxybenzonitrile
2024-83-1 3,4-Dimethoxybenzonitrile
نام محصول |
3,4-Dimethoxybenzonitrile |
نام انگلیسی |
3,4-Dimethoxybenzonitrile; Veratronitrile; 3,4-Dimethoybenzonitrile |
میدان مغناطیسی |
C9H9NO2 |
وزن مولکولی |
163.1733 |
InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,1-2H3 |
شماره سیایاس |
2024-83-1 |
تعداد کمیسیون اروپایی |
217-969-2 |
ساختار مولکولی |
|
تراکم |
1.12g/cm3 |
نقطه ذوب |
66-71℃ |
نقطه غلیان |
266.2°C at 760 mmHg |
ضریب شکست |
1.519 |
نقطه اشتعال |
107.5°C |
فشار بخار |
0.00877mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|