ChemNet > CAS > 20485-41-0 4-methylthiazole-5-carboxylic acid
20485-41-0 4-methylthiazole-5-carboxylic acid
نام محصول |
4-methylthiazole-5-carboxylic acid |
نام انگلیسی |
4-methylthiazole-5-carboxylic acid; 4-Methyl-thiazole-5-carboxylic acid; 4-Methylthiazole-5-Carboxylate; 4-methyl-1,3-thiazole-5-carboxylic acid; 4-Methyl-5-thiazolecarboxylic acid |
میدان مغناطیسی |
C10H9NO |
وزن مولکولی |
159.1846 |
InChI |
InChI=1/C10H9NO/c1-12-10-3-2-9-7-11-5-4-8(9)6-10/h2-7H,1H3 |
شماره سیایاس |
20485-41-0 |
ساختار مولکولی |
|
تراکم |
1.131g/cm3 |
نقطه ذوب |
250℃ |
نقطه غلیان |
295.593°C at 760 mmHg |
ضریب شکست |
1.611 |
نقطه اشتعال |
108.428°C |
فشار بخار |
0.003mmHg at 25°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|