2051-49-2 Hexanoic anhydride
نام محصول |
Hexanoic anhydride |
نام انگلیسی |
Hexanoic anhydride; Caproic anhydride; Hexanoic Acid Anhydride; N-hexanoic anhydride |
میدان مغناطیسی |
C12H22O3 |
وزن مولکولی |
214.3013 |
InChI |
InChI=1/C12H22O3/c1-3-5-7-9-11(13)15-12(14)10-8-6-4-2/h3-10H2,1-2H3 |
شماره سیایاس |
2051-49-2 |
تعداد کمیسیون اروپایی |
218-121-4 |
ساختار مولکولی |
|
تراکم |
0.943g/cm3 |
نقطه ذوب |
-40℃ |
نقطه غلیان |
247°C at 760 mmHg |
ضریب شکست |
1.436 |
نقطه اشتعال |
116.6°C |
فشار بخار |
0.0263mmHg at 25°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|