ChemNet > CAS > 2103-91-5 2-Amino-4-(p-tolyl)thiazole
2103-91-5 2-Amino-4-(p-tolyl)thiazole
نام محصول |
2-Amino-4-(p-tolyl)thiazole |
نام انگلیسی |
2-Amino-4-(p-tolyl)thiazole; 4-(4-Methylphenyl)-2-thiazolamine; 4-(4-methylphenyl)-1,3-thiazol-2-amine |
میدان مغناطیسی |
C10H10N2S |
وزن مولکولی |
190.2648 |
InChI |
InChI=1/C10H10N2S/c1-7-2-4-8(5-3-7)9-6-13-10(11)12-9/h2-6H,1H3,(H2,11,12) |
شماره سیایاس |
2103-91-5 |
ساختار مولکولی |
|
تراکم |
1.219g/cm3 |
نقطه ذوب |
132-136℃ |
نقطه غلیان |
369.4°C at 760 mmHg |
ضریب شکست |
1.642 |
نقطه اشتعال |
177.2°C |
فشار بخار |
1.19E-05mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|