ChemNet > CAS > 2113-51-1 2-Iodobiphenyl
2113-51-1 2-Iodobiphenyl
| نام محصول |
2-Iodobiphenyl |
| نام انگلیسی |
2-Iodobiphenyl;1,1'-Biphenyl, 2-iodo-; 2-Iodo-1,1'-biphenyl; AI3-15371; Biphenyl, 2-iodo-; NSC 9283; o-Iodobiphenyl; o-Phenyliodobenzene; Biphenyl, 2-iodo- (6CI,7CI,8CI) |
| میدان مغناطیسی |
C12H9I |
| وزن مولکولی |
280.1043 |
| InChI |
InChI=1/C12H9I/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| شماره سیایاس |
2113-51-1 |
| تعداد کمیسیون اروپایی |
218-303-3 |
| ساختار مولکولی |
|
| تراکم |
1.584g/cm3 |
| نقطه غلیان |
331.7°C at 760 mmHg |
| ضریب شکست |
1.64 |
| نقطه اشتعال |
150.1°C |
| فشار بخار |
0.000295mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
