2142-70-3 2-Iodoacetophenone
نام محصول |
2-Iodoacetophenone |
نام انگلیسی |
2-Iodoacetophenone; 2'-iodoacetophenone; 1-(2-iodophenyl)ethanone; Iodoacetophenone, 2'- |
میدان مغناطیسی |
C8H7IO |
وزن مولکولی |
246.045 |
InChI |
InChI=1/C8H7IO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
شماره سیایاس |
2142-70-3 |
ساختار مولکولی |
|
تراکم |
1.72g/cm3 |
نقطه غلیان |
268.2°C at 760 mmHg |
ضریب شکست |
1.603 |
نقطه اشتعال |
116°C |
فشار بخار |
0.00779mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|