ChemNet > CAS > 2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
| نام محصول |
3-(trifluoromethyl)phenoxyacetonitrile |
| نام انگلیسی |
3-(trifluoromethyl)phenoxyacetonitrile; 2-[3-(Trifluoromethyl)phenoxy]acetonitrile; methyl 4-fluoro-3-hydroxybenzoate |
| میدان مغناطیسی |
C8H7FO3 |
| وزن مولکولی |
170.1378 |
| InChI |
InChI=1/C8H7FO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3 |
| شماره سیایاس |
2145-31-5 |
| ساختار مولکولی |
|
| تراکم |
1.309g/cm3 |
| نقطه غلیان |
268.9°C at 760 mmHg |
| ضریب شکست |
1.526 |
| نقطه اشتعال |
116.4°C |
| فشار بخار |
0.00452mmHg at 25°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|
