ChemNet > CAS > 2150-43-8 Methyl 3,4-dihydroxybenzoate
2150-43-8 Methyl 3,4-dihydroxybenzoate
| نام محصول |
Methyl 3,4-dihydroxybenzoate |
| نام انگلیسی |
Methyl 3,4-dihydroxybenzoate; 3,4-Dihydroxybenzoic acid methyl ester; Methyl protocatechuate |
| میدان مغناطیسی |
C8H8O4 |
| وزن مولکولی |
168.1467 |
| InChI |
InChI=1/C8H8O4/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,9-10H,1H3 |
| شماره سیایاس |
2150-43-8 |
| ساختار مولکولی |
|
| تراکم |
1.354g/cm3 |
| نقطه غلیان |
351.5°C at 760 mmHg |
| ضریب شکست |
1.587 |
| نقطه اشتعال |
148.5°C |
| فشار بخار |
2.02E-05mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
