ChemNet > CAS > 2156-04-9 4-Vinylbenzeneboronic acid
2156-04-9 4-Vinylbenzeneboronic acid
| نام محصول |
4-Vinylbenzeneboronic acid |
| نام انگلیسی |
4-Vinylbenzeneboronic acid; 4-Vinylphenylboronic acid; Styrene-4-boronic acid; (4-ethenylphenyl)boronic acid |
| میدان مغناطیسی |
C8H9BO2 |
| وزن مولکولی |
147.9669 |
| InChI |
InChI=1/C8H9BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h2-6,10-11H,1H2 |
| شماره سیایاس |
2156-04-9 |
| ساختار مولکولی |
|
| تراکم |
1.09g/cm3 |
| نقطه ذوب |
188-189℃ |
| نقطه غلیان |
306.2°C at 760 mmHg |
| ضریب شکست |
1.539 |
| نقطه اشتعال |
139°C |
| فشار بخار |
0.000341mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
