2174-64-3 3,5-dihydroxyanisole
نام محصول |
3,5-dihydroxyanisole |
نام انگلیسی |
3,5-dihydroxyanisole;5-Methoxyresorcinol; Flamenol; ; 5-methoxybenzene-1,3-diol; 3,5-Dihydroxyanisole Hydrate |
میدان مغناطیسی |
C7H8O3 |
وزن مولکولی |
140.1366 |
InChI |
InChI=1/C7H8O3/c1-10-7-3-5(8)2-6(9)4-7/h2-4,8-9H,1H3 |
شماره سیایاس |
2174-64-3 |
تعداد کمیسیون اروپایی |
218-532-9 |
ساختار مولکولی |
|
تراکم |
1.27g/cm3 |
نقطه ذوب |
76--85℃ |
نقطه غلیان |
326.4°C at 760 mmHg |
ضریب شکست |
1.579 |
نقطه اشتعال |
122.5°C |
فشار بخار |
0.000114mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|