ChemNet > CAS > 2174-64-3 3,5-dihydroxyanisole
2174-64-3 3,5-dihydroxyanisole
| نام محصول |
3,5-dihydroxyanisole |
| نام انگلیسی |
3,5-dihydroxyanisole;5-Methoxyresorcinol; Flamenol; ; 5-methoxybenzene-1,3-diol; 3,5-Dihydroxyanisole Hydrate |
| میدان مغناطیسی |
C7H8O3 |
| وزن مولکولی |
140.1366 |
| InChI |
InChI=1/C7H8O3/c1-10-7-3-5(8)2-6(9)4-7/h2-4,8-9H,1H3 |
| شماره سیایاس |
2174-64-3 |
| تعداد کمیسیون اروپایی |
218-532-9 |
| ساختار مولکولی |
|
| تراکم |
1.27g/cm3 |
| نقطه ذوب |
76--85℃ |
| نقطه غلیان |
326.4°C at 760 mmHg |
| ضریب شکست |
1.579 |
| نقطه اشتعال |
122.5°C |
| فشار بخار |
0.000114mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
