ChemNet > CAS > 22236-04-0 2-(difluoromethoxy)aniline
22236-04-0 2-(difluoromethoxy)aniline
| نام محصول |
2-(difluoromethoxy)aniline |
| نام انگلیسی |
2-(difluoromethoxy)aniline; 2-Difluoromethoxyaniline |
| میدان مغناطیسی |
C7H7F2NO |
| وزن مولکولی |
159.1334 |
| InChI |
InChI=1/C7H7F2NO/c8-7(9)11-6-4-2-1-3-5(6)10/h1-4,7H,10H2 |
| شماره سیایاس |
22236-04-0 |
| ساختار مولکولی |
|
| تراکم |
1.253g/cm3 |
| نقطه غلیان |
209.8°C at 760 mmHg |
| ضریب شکست |
1.501 |
| نقطه اشتعال |
80.7°C |
| فشار بخار |
0.199mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
