ChemNet > CAS > 223671-15-6 7-Bromo-1-hydroxyisoquinoline
223671-15-6 7-Bromo-1-hydroxyisoquinoline
نام محصول |
7-Bromo-1-hydroxyisoquinoline |
نام انگلیسی |
7-Bromo-1-hydroxyisoquinoline; 7-Bromoisocarbostyril; 7-bromoisoquinolin-1(2H)-one; 7-bromo-1(2H)-isoquinolone |
میدان مغناطیسی |
C9H6BrNO |
وزن مولکولی |
224.054 |
InChI |
InChI=1/C9H6BrNO/c10-7-2-1-6-3-4-11-9(12)8(6)5-7/h1-5H,(H,11,12) |
شماره سیایاس |
223671-15-6 |
ساختار مولکولی |
|
تراکم |
1.62g/cm3 |
نقطه غلیان |
427.5°C at 760 mmHg |
ضریب شکست |
1.63 |
نقطه اشتعال |
212.4°C |
فشار بخار |
1.63E-07mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|