ChemNet > CAS > 2243-42-7 2-Phenoxybenzoic acid
2243-42-7 2-Phenoxybenzoic acid
| نام محصول |
2-Phenoxybenzoic acid |
| نام انگلیسی |
2-Phenoxybenzoic acid; 2-Carboxydiphenyl ether; 2-phenoxybenzoate |
| میدان مغناطیسی |
C13H9O3 |
| وزن مولکولی |
213.2093 |
| InChI |
InChI=1/C13H10O3/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10/h1-9H,(H,14,15)/p-1 |
| شماره سیایاس |
2243-42-7 |
| تعداد کمیسیون اروپایی |
218-811-5 |
| ساختار مولکولی |
|
| نقطه ذوب |
111-115℃ |
| نقطه غلیان |
343.3°C at 760 mmHg |
| نقطه اشتعال |
132°C |
| فشار بخار |
2.73E-05mmHg at 25°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
