ChemNet > CAS > 225104-76-7 3-Chloro-2,6-difluorobenzoic acid
225104-76-7 3-Chloro-2,6-difluorobenzoic acid
نام محصول |
3-Chloro-2,6-difluorobenzoic acid |
نام انگلیسی |
3-Chloro-2,6-difluorobenzoic acid; |
میدان مغناطیسی |
C7H3ClF2O2 |
وزن مولکولی |
192.5473 |
InChI |
InChI=1/C7H3ClF2O2/c8-3-1-2-4(9)5(6(3)10)7(11)12/h1-2H,(H,11,12) |
شماره سیایاس |
225104-76-7 |
ساختار مولکولی |
|
تراکم |
1.573g/cm3 |
نقطه غلیان |
264.5°C at 760 mmHg |
ضریب شکست |
1.534 |
نقطه اشتعال |
113.8°C |
فشار بخار |
0.00484mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|