ChemNet > CAS > 2265-91-0 1,3-Difluoro-5-iodobenzene
2265-91-0 1,3-Difluoro-5-iodobenzene
| نام محصول |
1,3-Difluoro-5-iodobenzene |
| نام انگلیسی |
1,3-Difluoro-5-iodobenzene; 3,5-DIFLUOROIODOBENZENE; 3,5-Difluoro iodobenzene |
| میدان مغناطیسی |
C6H3F2I |
| وزن مولکولی |
239.9893 |
| InChI |
InChI=1/C6H3F2I/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| شماره سیایاس |
2265-91-0 |
| ساختار مولکولی |
|
| تراکم |
2.001g/cm3 |
| نقطه غلیان |
173.9°C at 760 mmHg |
| ضریب شکست |
1.566 |
| نقطه اشتعال |
63.8°C |
| فشار بخار |
1.66mmHg at 25°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
