ChemNet > CAS > 22921-68-2 2-Bromo-5-methoxybenzoic acid
22921-68-2 2-Bromo-5-methoxybenzoic acid
نام محصول |
2-Bromo-5-methoxybenzoic acid |
نام انگلیسی |
2-Bromo-5-methoxybenzoic acid; 6-Bromo-m-anisic acid; 2-bromo-5-methoxybenzoate |
میدان مغناطیسی |
C8H6BrO3 |
وزن مولکولی |
230.036 |
InChI |
InChI=1/C8H7BrO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
شماره سیایاس |
22921-68-2 |
تعداد کمیسیون اروپایی |
245-329-2 |
ساختار مولکولی |
|
نقطه ذوب |
158-159℃ |
نقطه غلیان |
337.8°C at 760 mmHg |
نقطه اشتعال |
158.1°C |
فشار بخار |
4E-05mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|