2385-77-5 ( ) -سیترونلال؛
نام محصول |
( ) -سیترونلال؛ |
مترادف |
(R) -( ) -Citronellal؛ (R) -( ) -3،7-دی متیل-6-هشتی؛ |
نام انگلیسی |
(+)-citronellal; (R)-(+)-Citronellal; (R)-(+)-3,7-Dimethyl-6-octenal |
میدان مغناطیسی |
C10H18O |
وزن مولکولی |
154.25 |
InChI |
InChI=1/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3/t10-/m1/s1 |
شماره سیایاس |
2385-77-5 |
تعداد کمیسیون اروپایی |
219-194-5 |
ساختار مولکولی |
|
تراکم |
0.8554 |
نقطه غلیان |
201-204℃ |
ضریب شکست |
1.4467 |
نقطه اشتعال |
78℃ |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|