2401-24-3 6-Chloro-m-anisidine
نام محصول |
6-Chloro-m-anisidine |
نام انگلیسی |
6-Chloro-m-anisidine; 2-Chloro-5-methoxyaniline; 6-chloro-meta-anisidine; 3-Amino-4-chloroanisole |
میدان مغناطیسی |
C7H9Cl2NO |
وزن مولکولی |
194.0585 |
InChI |
InChI=1/C7H8ClNO.ClH/c1-10-5-2-3-6(8)7(9)4-5;/h2-4H,9H2,1H3;1H |
شماره سیایاس |
2401-24-3 |
تعداد کمیسیون اروپایی |
219-277-6 |
ساختار مولکولی |
|
نقطه ذوب |
207℃ |
نقطه غلیان |
255°C at 760 mmHg |
نقطه اشتعال |
108°C |
فشار بخار |
0.0168mmHg at 25°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|